C19H23N5O4S — CID 135968081
2-hydroxy-N,N-dimethyl-3-[[4-[[(1R)-1-(5-methylthiophen-2-yl)propyl]amino]-2-oxido-1,2,5-oxadiazol-2-ium-3-yl]amino]benzamide (PubChem CID 135968081) has the molecular formula C19H23N5O4S and a molecular weight of 417.49 g/mol. Its IUPAC name is 2-hydroxy-N,N-dimethyl-3-[[4-[[(1R)-1-(5-methylthiophen-2-yl)propyl]amino]-2-oxido-1,2,5-oxadiazol-2-ium-3-yl]amino]benzamide.
| Compound Name | 2-hydroxy-N,N-dimethyl-3-[[4-[[(1R)-1-(5-methylthiophen-2-yl)propyl]amino]-2-oxido-1,2,5-oxadiazol-2-ium-3-yl]amino]benzamide |
|---|---|
| PubChem CID | 135968081 |
| Molecular Formula | C19H23N5O4S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 2-hydroxy-N,N-dimethyl-3-[[4-[[(1R)-1-(5-methylthiophen-2-yl)propyl]amino]-2-oxido-1,2,5-oxadiazol-2-ium-3-yl]amino]benzamide |
| SMILES | CC[C@@H](Nc1no[n+]([O-])c1Nc1cccc(C(=O)N(C)C)c1O)c1ccc(C)s1 |
| InChI | InChI=1S/C19H23N5O4S/c1-5-13(15-10-9-11(2)29-15)20-17-18(24(27)28-22-17)21-14-8-6-7-12(16(14)25)19(26)23(3)4/h6-10,13,21,25H,5H2,1-4H3,(H,20,22)/t13-/m1/s1 |
| InChIKey | NTFBRLSKRYCBPB-CYBMUJFWSA-N |
| XLogP | 3.39 |
| TPSA | 117.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|