C19H23IN5O5S2- — CID 148909826
2-[[4-[[(R)-(5-methylfuran-2-yl)-methyliodanuidylmethyl]amino]-1-oxo-1,2,5-thiadiazol-3-yl]amino]-6-pyrrolidin-1-ylsulfonylphenol (PubChem CID 148909826) has the molecular formula C19H23IN5O5S2- and a molecular weight of 592.46 g/mol. Its IUPAC name is 2-[[4-[[(R)-(5-methylfuran-2-yl)-methyliodanuidylmethyl]amino]-1-oxo-1,2,5-thiadiazol-3-yl]amino]-6-pyrrolidin-1-ylsulfonylphenol.
| Compound Name | 2-[[4-[[(R)-(5-methylfuran-2-yl)-methyliodanuidylmethyl]amino]-1-oxo-1,2,5-thiadiazol-3-yl]amino]-6-pyrrolidin-1-ylsulfonylphenol |
|---|---|
| PubChem CID | 148909826 |
| Molecular Formula | C19H23IN5O5S2- |
| Molecular Weight | 592.46 g/mol |
| Exact Mass | 592.02 |
| IUPAC Name | 2-[[4-[[(R)-(5-methylfuran-2-yl)-methyliodanuidylmethyl]amino]-1-oxo-1,2,5-thiadiazol-3-yl]amino]-6-pyrrolidin-1-ylsulfonylphenol |
| SMILES | C[I-][C@@H](NC1=NS(=O)N=C1Nc1cccc(S(=O)(=O)N2CCCC2)c1O)c1ccc(C)o1 |
| InChI | InChI=1S/C19H23IN5O5S2/c1-12-8-9-14(30-12)17(20-2)22-19-18(23-31(27)24-19)21-13-6-5-7-15(16(13)26)32(28,29)25-10-3-4-11-25/h5-9,17,26H,3-4,10-11H2,1-2H3,(H,21,23)(H,22,24)/q-1/t17-,31?/m0/s1 |
| InChIKey | YEWPPKUUQQGAPH-AUBGMPCYSA-N |
| XLogP | -1.11 |
| TPSA | 136.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.46 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|