C16H24N4O5S2 — CID 143076827
3-ethoxy-4-methyl-1,2,5-thiadiazole 1-oxide;2-(methylamino)-6-pyrrolidin-1-ylsulfonylphenol (PubChem CID 143076827) has the molecular formula C16H24N4O5S2 and a molecular weight of 416.53 g/mol. Its IUPAC name is 3-ethoxy-4-methyl-1,2,5-thiadiazole 1-oxide;2-(methylamino)-6-pyrrolidin-1-ylsulfonylphenol.
| Compound Name | 3-ethoxy-4-methyl-1,2,5-thiadiazole 1-oxide;2-(methylamino)-6-pyrrolidin-1-ylsulfonylphenol |
|---|---|
| PubChem CID | 143076827 |
| Molecular Formula | C16H24N4O5S2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 3-ethoxy-4-methyl-1,2,5-thiadiazole 1-oxide;2-(methylamino)-6-pyrrolidin-1-ylsulfonylphenol |
| SMILES | CCOC1=NS(=O)N=C1C.CNc1cccc(S(=O)(=O)N2CCCC2)c1O |
| InChI | InChI=1S/C11H16N2O3S.C5H8N2O2S/c1-12-9-5-4-6-10(11(9)14)17(15,16)13-7-2-3-8-13;1-3-9-5-4(2)6-10(8)7-5/h4-6,12,14H,2-3,7-8H2,1H3;3H2,1-2H3 |
| InChIKey | LNNHZMKKBRWRFD-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 120.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|