C22H28ClN3O6S — CID 25112982
3-(4-chloro-2-hydroxy-3-pyrrolidin-1-ylsulfonylanilino)-4-[1-[(2R,5R)-5-methyloxolan-2-yl]propylamino]cyclobut-3-ene-1,2-dione (PubChem CID 25112982) has the molecular formula C22H28ClN3O6S and a molecular weight of 498.00 g/mol. Its IUPAC name is 3-(4-chloro-2-hydroxy-3-pyrrolidin-1-ylsulfonylanilino)-4-[1-[(2R,5R)-5-methyloxolan-2-yl]propylamino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(4-chloro-2-hydroxy-3-pyrrolidin-1-ylsulfonylanilino)-4-[1-[(2R,5R)-5-methyloxolan-2-yl]propylamino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 25112982 |
| Molecular Formula | C22H28ClN3O6S |
| Molecular Weight | 498.00 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | 3-(4-chloro-2-hydroxy-3-pyrrolidin-1-ylsulfonylanilino)-4-[1-[(2R,5R)-5-methyloxolan-2-yl]propylamino]cyclobut-3-ene-1,2-dione |
| SMILES | CCC(Nc1c(Nc2ccc(Cl)c(S(=O)(=O)N3CCCC3)c2O)c(=O)c1=O)[C@H]1CC[C@@H](C)O1 |
| InChI | InChI=1S/C22H28ClN3O6S/c1-3-14(16-9-6-12(2)32-16)24-17-18(21(29)20(17)28)25-15-8-7-13(23)22(19(15)27)33(30,31)26-10-4-5-11-26/h7-8,12,14,16,24-25,27H,3-6,9-11H2,1-2H3/t12-,14?,16-/m1/s1 |
| InChIKey | QFSJRFRQFHVMDR-QXDOLYAVSA-N |
| XLogP | 2.93 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.00 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|