C20H19ClN4O5S — CID 10298400
3-[3-[(3R)-3-aminopyrrolidin-1-yl]sulfonyl-4-chloro-2-hydroxyanilino]-4-anilinocyclobut-3-ene-1,2-dione (PubChem CID 10298400) has the molecular formula C20H19ClN4O5S and a molecular weight of 462.92 g/mol. Its IUPAC name is 3-[3-[(3R)-3-aminopyrrolidin-1-yl]sulfonyl-4-chloro-2-hydroxyanilino]-4-anilinocyclobut-3-ene-1,2-dione.
| Compound Name | 3-[3-[(3R)-3-aminopyrrolidin-1-yl]sulfonyl-4-chloro-2-hydroxyanilino]-4-anilinocyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 10298400 |
| Molecular Formula | C20H19ClN4O5S |
| Molecular Weight | 462.92 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | 3-[3-[(3R)-3-aminopyrrolidin-1-yl]sulfonyl-4-chloro-2-hydroxyanilino]-4-anilinocyclobut-3-ene-1,2-dione |
| SMILES | N[C@@H]1CCN(S(=O)(=O)c2c(Cl)ccc(Nc3c(Nc4ccccc4)c(=O)c3=O)c2O)C1 |
| InChI | InChI=1S/C20H19ClN4O5S/c21-13-6-7-14(17(26)20(13)31(29,30)25-9-8-11(22)10-25)24-16-15(18(27)19(16)28)23-12-4-2-1-3-5-12/h1-7,11,23-24,26H,8-10,22H2/t11-/m1/s1 |
| InChIKey | ZCIDGBSDCGPHOA-LLVKDONJSA-N |
| XLogP | 1.85 |
| TPSA | 141.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.92 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|