C20H20ClN5O6S — CID 163603789
6-chloro-3-[[2-(2-ethyl-2-phenylhydrazinyl)-3,4-dioxocyclobuten-1-yl]amino]-N-methoxy-N-methyl-2-nitrosobenzenesulfonamide (PubChem CID 163603789) has the molecular formula C20H20ClN5O6S and a molecular weight of 493.93 g/mol. Its IUPAC name is 6-chloro-3-[[2-(2-ethyl-2-phenylhydrazinyl)-3,4-dioxocyclobuten-1-yl]amino]-N-methoxy-N-methyl-2-nitrosobenzenesulfonamide.
| Compound Name | 6-chloro-3-[[2-(2-ethyl-2-phenylhydrazinyl)-3,4-dioxocyclobuten-1-yl]amino]-N-methoxy-N-methyl-2-nitrosobenzenesulfonamide |
|---|---|
| PubChem CID | 163603789 |
| Molecular Formula | C20H20ClN5O6S |
| Molecular Weight | 493.93 g/mol |
| Exact Mass | 493.08 |
| IUPAC Name | 6-chloro-3-[[2-(2-ethyl-2-phenylhydrazinyl)-3,4-dioxocyclobuten-1-yl]amino]-N-methoxy-N-methyl-2-nitrosobenzenesulfonamide |
| SMILES | CCN(Nc1c(Nc2ccc(Cl)c(S(=O)(=O)N(C)OC)c2N=O)c(=O)c1=O)c1ccccc1 |
| InChI | InChI=1S/C20H20ClN5O6S/c1-4-26(12-8-6-5-7-9-12)23-17-16(18(27)19(17)28)22-14-11-10-13(21)20(15(14)24-29)33(30,31)25(2)32-3/h5-11,22-23H,4H2,1-3H3 |
| InChIKey | GZZZZRKWEPDHNA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 137.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.93 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|