C20H18N2O4 — CID 22116200
2-[[2-(benzylamino)-3,4-dioxocyclobuten-1-yl]amino]-3-phenylpropanoic acid (PubChem CID 22116200) has the molecular formula C20H18N2O4 and a molecular weight of 350.37 g/mol. Its IUPAC name is 2-[[2-(benzylamino)-3,4-dioxocyclobuten-1-yl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[2-(benzylamino)-3,4-dioxocyclobuten-1-yl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 22116200 |
| Molecular Formula | C20H18N2O4 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 2-[[2-(benzylamino)-3,4-dioxocyclobuten-1-yl]amino]-3-phenylpropanoic acid |
| SMILES | O=C(O)C(Cc1ccccc1)Nc1c(NCc2ccccc2)c(=O)c1=O |
| InChI | InChI=1S/C20H18N2O4/c23-18-16(21-12-14-9-5-2-6-10-14)17(19(18)24)22-15(20(25)26)11-13-7-3-1-4-8-13/h1-10,15,21-22H,11-12H2,(H,25,26) |
| InChIKey | GTUWFULQFHTDEQ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|