C23H22N2O5 — CID 18669251
3-(4-benzoylphenyl)-2-[[3,4-dioxo-2-(propylamino)cyclobuten-1-yl]amino]propanoic acid (PubChem CID 18669251) has the molecular formula C23H22N2O5 and a molecular weight of 406.44 g/mol. Its IUPAC name is 3-(4-benzoylphenyl)-2-[[3,4-dioxo-2-(propylamino)cyclobuten-1-yl]amino]propanoic acid.
| Compound Name | 3-(4-benzoylphenyl)-2-[[3,4-dioxo-2-(propylamino)cyclobuten-1-yl]amino]propanoic acid |
|---|---|
| PubChem CID | 18669251 |
| Molecular Formula | C23H22N2O5 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 3-(4-benzoylphenyl)-2-[[3,4-dioxo-2-(propylamino)cyclobuten-1-yl]amino]propanoic acid |
| SMILES | CCCNc1c(NC(Cc2ccc(C(=O)c3ccccc3)cc2)C(=O)O)c(=O)c1=O |
| InChI | InChI=1S/C23H22N2O5/c1-2-12-24-18-19(22(28)21(18)27)25-17(23(29)30)13-14-8-10-16(11-9-14)20(26)15-6-4-3-5-7-15/h3-11,17,24-25H,2,12-13H2,1H3,(H,29,30) |
| InChIKey | NDLSKARXJLFEBB-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|