C27H28N4O4 — CID 18669338
2-[[3,4-dioxo-2-(pentylamino)cyclobuten-1-yl]amino]-3-[4-(isoquinolin-1-ylamino)phenyl]propanoic acid (PubChem CID 18669338) has the molecular formula C27H28N4O4 and a molecular weight of 472.55 g/mol. Its IUPAC name is 2-[[3,4-dioxo-2-(pentylamino)cyclobuten-1-yl]amino]-3-[4-(isoquinolin-1-ylamino)phenyl]propanoic acid.
| Compound Name | 2-[[3,4-dioxo-2-(pentylamino)cyclobuten-1-yl]amino]-3-[4-(isoquinolin-1-ylamino)phenyl]propanoic acid |
|---|---|
| PubChem CID | 18669338 |
| Molecular Formula | C27H28N4O4 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | 2-[[3,4-dioxo-2-(pentylamino)cyclobuten-1-yl]amino]-3-[4-(isoquinolin-1-ylamino)phenyl]propanoic acid |
| SMILES | CCCCCNc1c(NC(Cc2ccc(Nc3nccc4ccccc34)cc2)C(=O)O)c(=O)c1=O |
| InChI | InChI=1S/C27H28N4O4/c1-2-3-6-14-28-22-23(25(33)24(22)32)31-21(27(34)35)16-17-9-11-19(12-10-17)30-26-20-8-5-4-7-18(20)13-15-29-26/h4-5,7-13,15,21,28,31H,2-3,6,14,16H2,1H3,(H,29,30)(H,34,35) |
| InChIKey | NWYITEFBNSVXHW-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|