C24H22N4O5 — CID 18613987
2-[(3,4-dioxo-2-propan-2-yloxycyclobuten-1-yl)amino]-3-[4-(2,7-naphthyridin-1-ylamino)phenyl]propanoic acid (PubChem CID 18613987) has the molecular formula C24H22N4O5 and a molecular weight of 446.46 g/mol. Its IUPAC name is 2-[(3,4-dioxo-2-propan-2-yloxycyclobuten-1-yl)amino]-3-[4-(2,7-naphthyridin-1-ylamino)phenyl]propanoic acid.
| Compound Name | 2-[(3,4-dioxo-2-propan-2-yloxycyclobuten-1-yl)amino]-3-[4-(2,7-naphthyridin-1-ylamino)phenyl]propanoic acid |
|---|---|
| PubChem CID | 18613987 |
| Molecular Formula | C24H22N4O5 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 2-[(3,4-dioxo-2-propan-2-yloxycyclobuten-1-yl)amino]-3-[4-(2,7-naphthyridin-1-ylamino)phenyl]propanoic acid |
| SMILES | CC(C)Oc1c(NC(Cc2ccc(Nc3nccc4ccncc34)cc2)C(=O)O)c(=O)c1=O |
| InChI | InChI=1S/C24H22N4O5/c1-13(2)33-22-19(20(29)21(22)30)28-18(24(31)32)11-14-3-5-16(6-4-14)27-23-17-12-25-9-7-15(17)8-10-26-23/h3-10,12-13,18,28H,11H2,1-2H3,(H,26,27)(H,31,32) |
| InChIKey | SQLBLMNYUPWMQT-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 130.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|