C27H28N4O5 — CID 10299942
(2S)-2-[[2-(dipropylamino)-3,4-dioxocyclobuten-1-yl]amino]-3-[4-(2,7-naphthyridin-1-yloxy)phenyl]propanoic acid (PubChem CID 10299942) has the molecular formula C27H28N4O5 and a molecular weight of 488.54 g/mol. Its IUPAC name is (2S)-2-[[2-(dipropylamino)-3,4-dioxocyclobuten-1-yl]amino]-3-[4-(2,7-naphthyridin-1-yloxy)phenyl]propanoic acid.
| Compound Name | (2S)-2-[[2-(dipropylamino)-3,4-dioxocyclobuten-1-yl]amino]-3-[4-(2,7-naphthyridin-1-yloxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 10299942 |
| Molecular Formula | C27H28N4O5 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | (2S)-2-[[2-(dipropylamino)-3,4-dioxocyclobuten-1-yl]amino]-3-[4-(2,7-naphthyridin-1-yloxy)phenyl]propanoic acid |
| SMILES | CCCN(CCC)c1c(N[C@@H](Cc2ccc(Oc3nccc4ccncc34)cc2)C(=O)O)c(=O)c1=O |
| InChI | InChI=1S/C27H28N4O5/c1-3-13-31(14-4-2)23-22(24(32)25(23)33)30-21(27(34)35)15-17-5-7-19(8-6-17)36-26-20-16-28-11-9-18(20)10-12-29-26/h5-12,16,21,30H,3-4,13-15H2,1-2H3,(H,34,35)/t21-/m0/s1 |
| InChIKey | UQPSALOAFCBJAV-NRFANRHFSA-N |
| XLogP | 3.75 |
| TPSA | 121.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|