C20H23NO2 — CID 122651379
1-(4-benzoylphenyl)-4-methyl-2-(methylamino)pentan-3-one (PubChem CID 122651379) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is 1-(4-benzoylphenyl)-4-methyl-2-(methylamino)pentan-3-one.
| Compound Name | 1-(4-benzoylphenyl)-4-methyl-2-(methylamino)pentan-3-one |
|---|---|
| PubChem CID | 122651379 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 1-(4-benzoylphenyl)-4-methyl-2-(methylamino)pentan-3-one |
| SMILES | CNC(Cc1ccc(C(=O)c2ccccc2)cc1)C(=O)C(C)C |
| InChI | InChI=1S/C20H23NO2/c1-14(2)19(22)18(21-3)13-15-9-11-17(12-10-15)20(23)16-7-5-4-6-8-16/h4-12,14,18,21H,13H2,1-3H3 |
| InChIKey | BXSHNJWNVOBCCK-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |