C25H22O3 — CID 68503965
3-[(4-benzoylphenyl)methyl]-1-phenylpentane-2,4-dione (PubChem CID 68503965) has the molecular formula C25H22O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is 3-[(4-benzoylphenyl)methyl]-1-phenylpentane-2,4-dione.
| Compound Name | 3-[(4-benzoylphenyl)methyl]-1-phenylpentane-2,4-dione |
|---|---|
| PubChem CID | 68503965 |
| Molecular Formula | C25H22O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 3-[(4-benzoylphenyl)methyl]-1-phenylpentane-2,4-dione |
| SMILES | CC(=O)C(Cc1ccc(C(=O)c2ccccc2)cc1)C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C25H22O3/c1-18(26)23(24(27)17-19-8-4-2-5-9-19)16-20-12-14-22(15-13-20)25(28)21-10-6-3-7-11-21/h2-15,23H,16-17H2,1H3 |
| InChIKey | WYTMMOQFFMBIHQ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|