C12H11F3O2 — CID 151080618
3-benzyl-1,1,1-trifluoropentane-2,4-dione (PubChem CID 151080618) has the molecular formula C12H11F3O2 and a molecular weight of 244.21 g/mol. Its IUPAC name is 3-benzyl-1,1,1-trifluoropentane-2,4-dione.
| Compound Name | 3-benzyl-1,1,1-trifluoropentane-2,4-dione |
|---|---|
| PubChem CID | 151080618 |
| Molecular Formula | C12H11F3O2 |
| Molecular Weight | 244.21 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 3-benzyl-1,1,1-trifluoropentane-2,4-dione |
| SMILES | CC(=O)C(Cc1ccccc1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C12H11F3O2/c1-8(16)10(11(17)12(13,14)15)7-9-5-3-2-4-6-9/h2-6,10H,7H2,1H3 |
| InChIKey | MKAUELPAFGMJIE-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.21 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|