C11H9F3O4 — CID 175943046
2-benzyl-3-oxo-3-(trifluoromethoxy)propanoic acid (PubChem CID 175943046) has the molecular formula C11H9F3O4 and a molecular weight of 262.18 g/mol. Its IUPAC name is 2-benzyl-3-oxo-3-(trifluoromethoxy)propanoic acid.
| Compound Name | 2-benzyl-3-oxo-3-(trifluoromethoxy)propanoic acid |
|---|---|
| PubChem CID | 175943046 |
| Molecular Formula | C11H9F3O4 |
| Molecular Weight | 262.18 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | 2-benzyl-3-oxo-3-(trifluoromethoxy)propanoic acid |
| SMILES | O=C(O)C(Cc1ccccc1)C(=O)OC(F)(F)F |
| InChI | InChI=1S/C11H9F3O4/c12-11(13,14)18-10(17)8(9(15)16)6-7-4-2-1-3-5-7/h1-5,8H,6H2,(H,15,16) |
| InChIKey | CHSCZVMLSHMZEA-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.18 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|