C10H10F3NO3 — CID 87603238
3-phenyl-2-(trifluoromethoxyamino)propanoic acid (PubChem CID 87603238) has the molecular formula C10H10F3NO3 and a molecular weight of 249.19 g/mol. Its IUPAC name is 3-phenyl-2-(trifluoromethoxyamino)propanoic acid.
| Compound Name | 3-phenyl-2-(trifluoromethoxyamino)propanoic acid |
|---|---|
| PubChem CID | 87603238 |
| Molecular Formula | C10H10F3NO3 |
| Molecular Weight | 249.19 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 3-phenyl-2-(trifluoromethoxyamino)propanoic acid |
| SMILES | O=C(O)C(Cc1ccccc1)NOC(F)(F)F |
| InChI | InChI=1S/C10H10F3NO3/c11-10(12,13)17-14-8(9(15)16)6-7-4-2-1-3-5-7/h1-5,8,14H,6H2,(H,15,16) |
| InChIKey | SDYKOJXIEUEISO-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.19 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|