C12H12F3NO4 — CID 60706861
3-phenyl-2-(2,2,2-trifluoroethoxycarbonylamino)propanoic acid (PubChem CID 60706861) has the molecular formula C12H12F3NO4 and a molecular weight of 291.23 g/mol. Its IUPAC name is 3-phenyl-2-(2,2,2-trifluoroethoxycarbonylamino)propanoic acid.
| Compound Name | 3-phenyl-2-(2,2,2-trifluoroethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 60706861 |
| Molecular Formula | C12H12F3NO4 |
| Molecular Weight | 291.23 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 3-phenyl-2-(2,2,2-trifluoroethoxycarbonylamino)propanoic acid |
| SMILES | O=C(NC(Cc1ccccc1)C(=O)O)OCC(F)(F)F |
| InChI | InChI=1S/C12H12F3NO4/c13-12(14,15)7-20-11(19)16-9(10(17)18)6-8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,16,19)(H,17,18) |
| InChIKey | QWGAWHKCBDAEAF-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.23 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |