C16H18O6 — CID 141240028
2-[[3-(2-carboxy-3-oxobutyl)phenyl]methyl]-3-oxobutanoic acid (PubChem CID 141240028) has the molecular formula C16H18O6 and a molecular weight of 306.31 g/mol. Its IUPAC name is 2-[[3-(2-carboxy-3-oxobutyl)phenyl]methyl]-3-oxobutanoic acid.
| Compound Name | 2-[[3-(2-carboxy-3-oxobutyl)phenyl]methyl]-3-oxobutanoic acid |
|---|---|
| PubChem CID | 141240028 |
| Molecular Formula | C16H18O6 |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 2-[[3-(2-carboxy-3-oxobutyl)phenyl]methyl]-3-oxobutanoic acid |
| SMILES | CC(=O)C(Cc1cccc(CC(C(C)=O)C(=O)O)c1)C(=O)O |
| InChI | InChI=1S/C16H18O6/c1-9(17)13(15(19)20)7-11-4-3-5-12(6-11)8-14(10(2)18)16(21)22/h3-6,13-14H,7-8H2,1-2H3,(H,19,20)(H,21,22) |
| InChIKey | RXSNBFPOFQFXCH-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|