C24H32N2O2 — CID 171756988
N-(4-methyl-3-oxo-1-phenylpentan-2-yl)-3-phenyl-2-(propan-2-ylamino)propanamide (PubChem CID 171756988) has the molecular formula C24H32N2O2 and a molecular weight of 380.53 g/mol. Its IUPAC name is N-(4-methyl-3-oxo-1-phenylpentan-2-yl)-3-phenyl-2-(propan-2-ylamino)propanamide.
| Compound Name | N-(4-methyl-3-oxo-1-phenylpentan-2-yl)-3-phenyl-2-(propan-2-ylamino)propanamide |
|---|---|
| PubChem CID | 171756988 |
| Molecular Formula | C24H32N2O2 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.25 |
| IUPAC Name | N-(4-methyl-3-oxo-1-phenylpentan-2-yl)-3-phenyl-2-(propan-2-ylamino)propanamide |
| SMILES | CC(C)NC(Cc1ccccc1)C(=O)NC(Cc1ccccc1)C(=O)C(C)C |
| InChI | InChI=1S/C24H32N2O2/c1-17(2)23(27)21(15-19-11-7-5-8-12-19)26-24(28)22(25-18(3)4)16-20-13-9-6-10-14-20/h5-14,17-18,21-22,25H,15-16H2,1-4H3,(H,26,28) |
| InChIKey | ZIVWVBUZVGZQPE-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |