C17H22F2N2O4 — CID 59990529
5,5-difluoro-2-oxo-3-[[(2S)-3-phenyl-2-(propan-2-ylamino)propanoyl]amino]pentanoic acid (PubChem CID 59990529) has the molecular formula C17H22F2N2O4 and a molecular weight of 356.37 g/mol. Its IUPAC name is 5,5-difluoro-2-oxo-3-[[(2S)-3-phenyl-2-(propan-2-ylamino)propanoyl]amino]pentanoic acid.
| Compound Name | 5,5-difluoro-2-oxo-3-[[(2S)-3-phenyl-2-(propan-2-ylamino)propanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 59990529 |
| Molecular Formula | C17H22F2N2O4 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 5,5-difluoro-2-oxo-3-[[(2S)-3-phenyl-2-(propan-2-ylamino)propanoyl]amino]pentanoic acid |
| SMILES | CC(C)N[C@@H](Cc1ccccc1)C(=O)NC(CC(F)F)C(=O)C(=O)O |
| InChI | InChI=1S/C17H22F2N2O4/c1-10(2)20-13(8-11-6-4-3-5-7-11)16(23)21-12(9-14(18)19)15(22)17(24)25/h3-7,10,12-14,20H,8-9H2,1-2H3,(H,21,23)(H,24,25)/t12?,13-/m0/s1 |
| InChIKey | GKQIBHZBBUTCPQ-ABLWVSNPSA-N |
| XLogP | 1.39 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|