molecular hydrogen;1-phenyl-2-(propan-2-ylamino)pentan-3-one

C14H23NO — CID 176556293

IUPACmolecular hydrogen;1-phenyl-2-(propan-2-ylamino)pentan-3-one
SMILESCCC(=O)C(Cc1ccccc1)NC(C)C.[H][H]
InChIInChI=1S/C14H21NO.H2/c1-4-14(16)13(15-11(2)3)10-12-8-6-5-7-9-12;/h5-9,11,13,15H,4,10H2,1-3H3;1H
InChIKeyORUJFMJUTYAUNV-UHFFFAOYSA-N
MW221.34 g/mol
LogP2.82
Rot. Bonds6

About molecular hydrogen;1-phenyl-2-(propan-2-ylamino)pentan-3-one

molecular hydrogen;1-phenyl-2-(propan-2-ylamino)pentan-3-one (PubChem CID 176556293) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is molecular hydrogen;1-phenyl-2-(propan-2-ylamino)pentan-3-one.

Molecular Properties

Compound Namemolecular hydrogen;1-phenyl-2-(propan-2-ylamino)pentan-3-one
PubChem CID176556293
Molecular FormulaC14H23NO
Molecular Weight221.34 g/mol
Exact Mass221.18
IUPAC Namemolecular hydrogen;1-phenyl-2-(propan-2-ylamino)pentan-3-one
SMILESCCC(=O)C(Cc1ccccc1)NC(C)C.[H][H]
InChIInChI=1S/C14H21NO.H2/c1-4-14(16)13(15-11(2)3)10-12-8-6-5-7-9-12;/h5-9,11,13,15H,4,10H2,1-3H3;1H
InChIKeyORUJFMJUTYAUNV-UHFFFAOYSA-N
XLogP2.82
TPSA29.10 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500221.34
LogP ≤ 52.82
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze molecular hydrogen;1-phenyl-2-(propan-2-ylamino)pentan-3-one with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of molecular hydrogen;1-phenyl-2-(propan-2-ylamino)pentan-3-one?
The IUPAC name of molecular hydrogen;1-phenyl-2-(propan-2-ylamino)pentan-3-one (CID 176556293) is molecular hydrogen;1-phenyl-2-(propan-2-ylamino)pentan-3-one.
What is the SMILES notation for molecular hydrogen;1-phenyl-2-(propan-2-ylamino)pentan-3-one?
The canonical SMILES for molecular hydrogen;1-phenyl-2-(propan-2-ylamino)pentan-3-one is CCC(=O)C(Cc1ccccc1)NC(C)C.[H][H].
What is the InChIKey of molecular hydrogen;1-phenyl-2-(propan-2-ylamino)pentan-3-one?
The InChIKey is ORUJFMJUTYAUNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO.H2/c1-4-14(16)13(15-11(2)3)10-12-8-6-5-7-9-12;/h5-9,11,13,15H,4,10H2,1-3H3;1H.
What are the key properties of molecular hydrogen;1-phenyl-2-(propan-2-ylamino)pentan-3-one?
molecular hydrogen;1-phenyl-2-(propan-2-ylamino)pentan-3-one has a molecular weight of 221.34 g/mol, XLogP of 2.82, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;1-phenyl-2-(propan-2-ylamino)pentan-3-one is sourced from PubChem (CID 176556293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).