C14H23NO — CID 176556293
molecular hydrogen;1-phenyl-2-(propan-2-ylamino)pentan-3-one (PubChem CID 176556293) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is molecular hydrogen;1-phenyl-2-(propan-2-ylamino)pentan-3-one.
| Compound Name | molecular hydrogen;1-phenyl-2-(propan-2-ylamino)pentan-3-one |
|---|---|
| PubChem CID | 176556293 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | molecular hydrogen;1-phenyl-2-(propan-2-ylamino)pentan-3-one |
| SMILES | CCC(=O)C(Cc1ccccc1)NC(C)C.[H][H] |
| InChI | InChI=1S/C14H21NO.H2/c1-4-14(16)13(15-11(2)3)10-12-8-6-5-7-9-12;/h5-9,11,13,15H,4,10H2,1-3H3;1H |
| InChIKey | ORUJFMJUTYAUNV-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |