C22H27ClN4O4S — CID 143936815
3-[4-chloro-3-[ethyl(methoxy)amino]sulfanyl-2-hydroxyanilino]-4-[[(4Z,6Z)-4-(methylideneamino)octa-4,6-dien-3-yl]amino]cyclobut-3-ene-1,2-dione (PubChem CID 143936815) has the molecular formula C22H27ClN4O4S and a molecular weight of 479.00 g/mol. Its IUPAC name is 3-[4-chloro-3-[ethyl(methoxy)amino]sulfanyl-2-hydroxyanilino]-4-[[(4Z,6Z)-4-(methylideneamino)octa-4,6-dien-3-yl]amino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[4-chloro-3-[ethyl(methoxy)amino]sulfanyl-2-hydroxyanilino]-4-[[(4Z,6Z)-4-(methylideneamino)octa-4,6-dien-3-yl]amino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 143936815 |
| Molecular Formula | C22H27ClN4O4S |
| Molecular Weight | 479.00 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | 3-[4-chloro-3-[ethyl(methoxy)amino]sulfanyl-2-hydroxyanilino]-4-[[(4Z,6Z)-4-(methylideneamino)octa-4,6-dien-3-yl]amino]cyclobut-3-ene-1,2-dione |
| SMILES | C=N/C(=C\C=C/C)C(CC)Nc1c(Nc2ccc(Cl)c(SN(CC)OC)c2O)c(=O)c1=O |
| InChI | InChI=1S/C22H27ClN4O4S/c1-6-9-10-15(24-4)14(7-2)25-17-18(21(30)20(17)29)26-16-12-11-13(23)22(19(16)28)32-27(8-3)31-5/h6,9-12,14,25-26,28H,4,7-8H2,1-3,5H3/b9-6-,15-10- |
| InChIKey | CGUIPEWKLZGSEK-IAGWCDOLSA-N |
| XLogP | 4.63 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.00 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|