C25H31N3O5 — CID 142180643
3-(benzylamino)-4-[2-hydroxy-3-(pyrrolidine-1-carbonyl)anilino]cyclobut-3-ene-1,2-dione;ethane;methanol (PubChem CID 142180643) has the molecular formula C25H31N3O5 and a molecular weight of 453.54 g/mol. Its IUPAC name is 3-(benzylamino)-4-[2-hydroxy-3-(pyrrolidine-1-carbonyl)anilino]cyclobut-3-ene-1,2-dione;ethane;methanol.
| Compound Name | 3-(benzylamino)-4-[2-hydroxy-3-(pyrrolidine-1-carbonyl)anilino]cyclobut-3-ene-1,2-dione;ethane;methanol |
|---|---|
| PubChem CID | 142180643 |
| Molecular Formula | C25H31N3O5 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | 3-(benzylamino)-4-[2-hydroxy-3-(pyrrolidine-1-carbonyl)anilino]cyclobut-3-ene-1,2-dione;ethane;methanol |
| SMILES | CC.CO.O=C(c1cccc(Nc2c(NCc3ccccc3)c(=O)c2=O)c1O)N1CCCC1 |
| InChI | InChI=1S/C22H21N3O4.C2H6.CH4O/c26-19-15(22(29)25-11-4-5-12-25)9-6-10-16(19)24-18-17(20(27)21(18)28)23-13-14-7-2-1-3-8-14;2*1-2/h1-3,6-10,23-24,26H,4-5,11-13H2;1-2H3;2H,1H3 |
| InChIKey | YDIDFVGHDQTARE-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|