C23H25N3O5 — CID 59068162
3-[(2-anilino-3,4-dioxocyclobuten-1-yl)amino]-2-hydroxy-N-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]benzamide (PubChem CID 59068162) has the molecular formula C23H25N3O5 and a molecular weight of 423.47 g/mol. Its IUPAC name is 3-[(2-anilino-3,4-dioxocyclobuten-1-yl)amino]-2-hydroxy-N-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]benzamide.
| Compound Name | 3-[(2-anilino-3,4-dioxocyclobuten-1-yl)amino]-2-hydroxy-N-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]benzamide |
|---|---|
| PubChem CID | 59068162 |
| Molecular Formula | C23H25N3O5 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 3-[(2-anilino-3,4-dioxocyclobuten-1-yl)amino]-2-hydroxy-N-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]benzamide |
| SMILES | CC(C)(C)[C@@H](CO)NC(=O)c1cccc(Nc2c(Nc3ccccc3)c(=O)c2=O)c1O |
| InChI | InChI=1S/C23H25N3O5/c1-23(2,3)16(12-27)26-22(31)14-10-7-11-15(19(14)28)25-18-17(20(29)21(18)30)24-13-8-5-4-6-9-13/h4-11,16,24-25,27-28H,12H2,1-3H3,(H,26,31)/t16-/m1/s1 |
| InChIKey | XPZBGEPOLMVXEI-MRXNPFEDSA-N |
| XLogP | 2.61 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|