C24H25N3O4 — CID 10136860
3-[2-hydroxy-3-(pyrrolidine-1-carbonyl)anilino]-4-[[(1R)-1-phenylpropyl]amino]cyclobut-3-ene-1,2-dione (PubChem CID 10136860) has the molecular formula C24H25N3O4 and a molecular weight of 419.48 g/mol. Its IUPAC name is 3-[2-hydroxy-3-(pyrrolidine-1-carbonyl)anilino]-4-[[(1R)-1-phenylpropyl]amino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[2-hydroxy-3-(pyrrolidine-1-carbonyl)anilino]-4-[[(1R)-1-phenylpropyl]amino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 10136860 |
| Molecular Formula | C24H25N3O4 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | 3-[2-hydroxy-3-(pyrrolidine-1-carbonyl)anilino]-4-[[(1R)-1-phenylpropyl]amino]cyclobut-3-ene-1,2-dione |
| SMILES | CC[C@@H](Nc1c(Nc2cccc(C(=O)N3CCCC3)c2O)c(=O)c1=O)c1ccccc1 |
| InChI | InChI=1S/C24H25N3O4/c1-2-17(15-9-4-3-5-10-15)25-19-20(23(30)22(19)29)26-18-12-8-11-16(21(18)28)24(31)27-13-6-7-14-27/h3-5,8-12,17,25-26,28H,2,6-7,13-14H2,1H3/t17-/m1/s1 |
| InChIKey | PRHPTOABMFCCAL-QGZVFWFLSA-N |
| XLogP | 3.53 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|