C17H11BrN2O5 — CID 59068153
3-[[2-(2-bromoanilino)-3,4-dioxocyclobuten-1-yl]amino]-2-hydroxybenzoic acid (PubChem CID 59068153) has the molecular formula C17H11BrN2O5 and a molecular weight of 403.19 g/mol. Its IUPAC name is 3-[[2-(2-bromoanilino)-3,4-dioxocyclobuten-1-yl]amino]-2-hydroxybenzoic acid.
| Compound Name | 3-[[2-(2-bromoanilino)-3,4-dioxocyclobuten-1-yl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 59068153 |
| Molecular Formula | C17H11BrN2O5 |
| Molecular Weight | 403.19 g/mol |
| Exact Mass | 401.99 |
| IUPAC Name | 3-[[2-(2-bromoanilino)-3,4-dioxocyclobuten-1-yl]amino]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1cccc(Nc2c(Nc3ccccc3Br)c(=O)c2=O)c1O |
| InChI | InChI=1S/C17H11BrN2O5/c18-9-5-1-2-6-10(9)19-12-13(16(23)15(12)22)20-11-7-3-4-8(14(11)21)17(24)25/h1-7,19-21H,(H,24,25) |
| InChIKey | YXGHIXSBGNOXTI-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.19 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|