C17H11BrN2O4 — CID 18473844
2-[[2-(3-bromoanilino)-3,4-dioxocyclobuten-1-yl]amino]benzoic acid (PubChem CID 18473844) has the molecular formula C17H11BrN2O4 and a molecular weight of 387.19 g/mol. Its IUPAC name is 2-[[2-(3-bromoanilino)-3,4-dioxocyclobuten-1-yl]amino]benzoic acid.
| Compound Name | 2-[[2-(3-bromoanilino)-3,4-dioxocyclobuten-1-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 18473844 |
| Molecular Formula | C17H11BrN2O4 |
| Molecular Weight | 387.19 g/mol |
| Exact Mass | 385.99 |
| IUPAC Name | 2-[[2-(3-bromoanilino)-3,4-dioxocyclobuten-1-yl]amino]benzoic acid |
| SMILES | O=C(O)c1ccccc1Nc1c(Nc2cccc(Br)c2)c(=O)c1=O |
| InChI | InChI=1S/C17H11BrN2O4/c18-9-4-3-5-10(8-9)19-13-14(16(22)15(13)21)20-12-7-2-1-6-11(12)17(23)24/h1-8,19-20H,(H,23,24) |
| InChIKey | XCWIQASEFUBHJG-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.19 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|