C21H20N2O6 — CID 75490689
methyl 2-[[2-[(3,4-dimethoxyphenyl)methylamino]-3,4-dioxocyclobuten-1-yl]amino]benzoate (PubChem CID 75490689) has the molecular formula C21H20N2O6 and a molecular weight of 396.40 g/mol. Its IUPAC name is methyl 2-[[2-[(3,4-dimethoxyphenyl)methylamino]-3,4-dioxocyclobuten-1-yl]amino]benzoate.
| Compound Name | methyl 2-[[2-[(3,4-dimethoxyphenyl)methylamino]-3,4-dioxocyclobuten-1-yl]amino]benzoate |
|---|---|
| PubChem CID | 75490689 |
| Molecular Formula | C21H20N2O6 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | methyl 2-[[2-[(3,4-dimethoxyphenyl)methylamino]-3,4-dioxocyclobuten-1-yl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1Nc1c(NCc2ccc(OC)c(OC)c2)c(=O)c1=O |
| InChI | InChI=1S/C21H20N2O6/c1-27-15-9-8-12(10-16(15)28-2)11-22-17-18(20(25)19(17)24)23-14-7-5-4-6-13(14)21(26)29-3/h4-10,22-23H,11H2,1-3H3 |
| InChIKey | DZCUTAZZYVIUGF-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|