C17H19NO5S — CID 51143121
N-[(3,4-dimethoxyphenyl)methyl]-2-methylsulfonylbenzamide (PubChem CID 51143121) has the molecular formula C17H19NO5S and a molecular weight of 349.41 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-2-methylsulfonylbenzamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-2-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 51143121 |
| Molecular Formula | C17H19NO5S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-2-methylsulfonylbenzamide |
| SMILES | COc1ccc(CNC(=O)c2ccccc2S(C)(=O)=O)cc1OC |
| InChI | InChI=1S/C17H19NO5S/c1-22-14-9-8-12(10-15(14)23-2)11-18-17(19)13-6-4-5-7-16(13)24(3,20)21/h4-10H,11H2,1-3H3,(H,18,19) |
| InChIKey | OBPUKEBWZBEPPF-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |