C16H17BrN2O5S — CID 55349817
2-bromo-N-[(3,4-dimethoxyphenyl)methyl]-5-sulfamoylbenzamide (PubChem CID 55349817) has the molecular formula C16H17BrN2O5S and a molecular weight of 429.29 g/mol. Its IUPAC name is 2-bromo-N-[(3,4-dimethoxyphenyl)methyl]-5-sulfamoylbenzamide.
| Compound Name | 2-bromo-N-[(3,4-dimethoxyphenyl)methyl]-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 55349817 |
| Molecular Formula | C16H17BrN2O5S |
| Molecular Weight | 429.29 g/mol |
| Exact Mass | 428.00 |
| IUPAC Name | 2-bromo-N-[(3,4-dimethoxyphenyl)methyl]-5-sulfamoylbenzamide |
| SMILES | COc1ccc(CNC(=O)c2cc(S(N)(=O)=O)ccc2Br)cc1OC |
| InChI | InChI=1S/C16H17BrN2O5S/c1-23-14-6-3-10(7-15(14)24-2)9-19-16(20)12-8-11(25(18,21)22)4-5-13(12)17/h3-8H,9H2,1-2H3,(H,19,20)(H2,18,21,22) |
| InChIKey | LVHUIOVRDONTKE-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.29 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |