C17H19NO3S — CID 92532211
N-[(3,4-dimethoxyphenyl)methyl]-2-methylsulfanylbenzamide (PubChem CID 92532211) has the molecular formula C17H19NO3S and a molecular weight of 317.41 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-2-methylsulfanylbenzamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-2-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 92532211 |
| Molecular Formula | C17H19NO3S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-2-methylsulfanylbenzamide |
| SMILES | COc1ccc(CNC(=O)c2ccccc2SC)cc1OC |
| InChI | InChI=1S/C17H19NO3S/c1-20-14-9-8-12(10-15(14)21-2)11-18-17(19)13-6-4-5-7-16(13)22-3/h4-10H,11H2,1-3H3,(H,18,19) |
| InChIKey | PXUNPGCRQPFGEC-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |