C20H21NO7 — CID 7766660
methyl 2-[[2-[2-(3,4-dimethoxyphenyl)acetyl]oxyacetyl]amino]benzoate (PubChem CID 7766660) has the molecular formula C20H21NO7 and a molecular weight of 387.39 g/mol. Its IUPAC name is methyl 2-[[2-[2-(3,4-dimethoxyphenyl)acetyl]oxyacetyl]amino]benzoate.
| Compound Name | methyl 2-[[2-[2-(3,4-dimethoxyphenyl)acetyl]oxyacetyl]amino]benzoate |
|---|---|
| PubChem CID | 7766660 |
| Molecular Formula | C20H21NO7 |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | methyl 2-[[2-[2-(3,4-dimethoxyphenyl)acetyl]oxyacetyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)COC(=O)Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C20H21NO7/c1-25-16-9-8-13(10-17(16)26-2)11-19(23)28-12-18(22)21-15-7-5-4-6-14(15)20(24)27-3/h4-10H,11-12H2,1-3H3,(H,21,22) |
| InChIKey | IQIYOPRGSOMZKD-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |