C21H28N4O4 — CID 142856723
3-[amino-[2-(benzylamino)-4-oxocyclobuten-1-yl]amino]-2-hydroxybenzamide;ethane;methanol (PubChem CID 142856723) has the molecular formula C21H28N4O4 and a molecular weight of 400.48 g/mol. Its IUPAC name is 3-[amino-[2-(benzylamino)-4-oxocyclobuten-1-yl]amino]-2-hydroxybenzamide;ethane;methanol.
| Compound Name | 3-[amino-[2-(benzylamino)-4-oxocyclobuten-1-yl]amino]-2-hydroxybenzamide;ethane;methanol |
|---|---|
| PubChem CID | 142856723 |
| Molecular Formula | C21H28N4O4 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | 3-[amino-[2-(benzylamino)-4-oxocyclobuten-1-yl]amino]-2-hydroxybenzamide;ethane;methanol |
| SMILES | CC.CO.NC(=O)c1cccc(N(N)C2=C(NCc3ccccc3)CC2=O)c1O |
| InChI | InChI=1S/C18H18N4O3.C2H6.CH4O/c19-18(25)12-7-4-8-14(17(12)24)22(20)16-13(9-15(16)23)21-10-11-5-2-1-3-6-11;2*1-2/h1-8,21,24H,9-10,20H2,(H2,19,25);1-2H3;2H,1H3 |
| InChIKey | AIBIDFZDYRVMKP-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 141.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|