C11H13N5O3S — CID 136594862
3-[(4-amino-1-oxo-1,2,5-thiadiazol-3-yl)amino]-2-hydroxy-N,N-dimethylbenzamide (PubChem CID 136594862) has the molecular formula C11H13N5O3S and a molecular weight of 295.32 g/mol. Its IUPAC name is 3-[(4-amino-1-oxo-1,2,5-thiadiazol-3-yl)amino]-2-hydroxy-N,N-dimethylbenzamide.
| Compound Name | 3-[(4-amino-1-oxo-1,2,5-thiadiazol-3-yl)amino]-2-hydroxy-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 136594862 |
| Molecular Formula | C11H13N5O3S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 3-[(4-amino-1-oxo-1,2,5-thiadiazol-3-yl)amino]-2-hydroxy-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cccc(NC2=NS(=O)N=C2N)c1O |
| InChI | InChI=1S/C11H13N5O3S/c1-16(2)11(18)6-4-3-5-7(8(6)17)13-10-9(12)14-20(19)15-10/h3-5,17H,1-2H3,(H2,12,14)(H,13,15) |
| InChIKey | NICRGDZZVLAYIZ-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 120.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|