C29H32N4O11 — CID 160573719
3-amino-2-hydroxy-N,N-dimethylbenzamide;3,4-dimethoxycyclobut-3-ene-1,2-dione;2-hydroxy-3-[(2-methoxy-3,4-dioxocyclobuten-1-yl)amino]-N,N-dimethylbenzamide (PubChem CID 160573719) has the molecular formula C29H32N4O11 and a molecular weight of 612.59 g/mol. Its IUPAC name is 3-amino-2-hydroxy-N,N-dimethylbenzamide;3,4-dimethoxycyclobut-3-ene-1,2-dione;2-hydroxy-3-[(2-methoxy-3,4-dioxocyclobuten-1-yl)amino]-N,N-dimethylbenzamide.
| Compound Name | 3-amino-2-hydroxy-N,N-dimethylbenzamide;3,4-dimethoxycyclobut-3-ene-1,2-dione;2-hydroxy-3-[(2-methoxy-3,4-dioxocyclobuten-1-yl)amino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 160573719 |
| Molecular Formula | C29H32N4O11 |
| Molecular Weight | 612.59 g/mol |
| Exact Mass | 612.21 |
| IUPAC Name | 3-amino-2-hydroxy-N,N-dimethylbenzamide;3,4-dimethoxycyclobut-3-ene-1,2-dione;2-hydroxy-3-[(2-methoxy-3,4-dioxocyclobuten-1-yl)amino]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cccc(N)c1O.COc1c(Nc2cccc(C(=O)N(C)C)c2O)c(=O)c1=O.COc1c(OC)c(=O)c1=O |
| InChI | InChI=1S/C14H14N2O5.C9H12N2O2.C6H6O4/c1-16(2)14(20)7-5-4-6-8(10(7)17)15-9-11(18)12(19)13(9)21-3;1-11(2)9(13)6-4-3-5-7(10)8(6)12;1-9-5-3(7)4(8)6(5)10-2/h4-6,15,17H,1-3H3;3-5,12H,10H2,1-2H3;1-2H3 |
| InChIKey | RAWJATKGBFHMBR-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 215.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.59 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|