C20H20LiN3O5 — CID 142180198
lithium [2-[3-(dimethylcarbamoyl)-2-hydroxyanilino]-3,4-dioxocyclobuten-1-yl]-[1-(furan-2-yl)propyl]azanide (PubChem CID 142180198) has the molecular formula C20H20LiN3O5 and a molecular weight of 389.34 g/mol. Its IUPAC name is lithium [2-[3-(dimethylcarbamoyl)-2-hydroxyanilino]-3,4-dioxocyclobuten-1-yl]-[1-(furan-2-yl)propyl]azanide.
| Compound Name | lithium [2-[3-(dimethylcarbamoyl)-2-hydroxyanilino]-3,4-dioxocyclobuten-1-yl]-[1-(furan-2-yl)propyl]azanide |
|---|---|
| PubChem CID | 142180198 |
| Molecular Formula | C20H20LiN3O5 |
| Molecular Weight | 389.34 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | lithium [2-[3-(dimethylcarbamoyl)-2-hydroxyanilino]-3,4-dioxocyclobuten-1-yl]-[1-(furan-2-yl)propyl]azanide |
| SMILES | CCC([N-]c1c(Nc2cccc(C(=O)N(C)C)c2O)c(=O)c1=O)c1ccco1.[Li+] |
| InChI | InChI=1S/C20H21N3O5.Li/c1-4-12(14-9-6-10-28-14)21-15-16(19(26)18(15)25)22-13-8-5-7-11(17(13)24)20(27)23(2)3;/h5-10,12H,4H2,1-3H3,(H3,21,22,24,25,26,27);/q;+1/p-1 |
| InChIKey | DJHDWEZEPPFSJU-UHFFFAOYSA-M |
| XLogP | 0.19 |
| TPSA | 113.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.34 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|