C25H26LiN3O4 — CID 142180139
lithium [2-[3-(dimethylcarbamoyl)-2-hydroxyanilino]-3,4-dioxocyclobuten-1-yl]-[(1R,2S)-2-phenylcyclohexyl]azanide (PubChem CID 142180139) has the molecular formula C25H26LiN3O4 and a molecular weight of 439.44 g/mol. Its IUPAC name is lithium [2-[3-(dimethylcarbamoyl)-2-hydroxyanilino]-3,4-dioxocyclobuten-1-yl]-[(1R,2S)-2-phenylcyclohexyl]azanide.
| Compound Name | lithium [2-[3-(dimethylcarbamoyl)-2-hydroxyanilino]-3,4-dioxocyclobuten-1-yl]-[(1R,2S)-2-phenylcyclohexyl]azanide |
|---|---|
| PubChem CID | 142180139 |
| Molecular Formula | C25H26LiN3O4 |
| Molecular Weight | 439.44 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | lithium [2-[3-(dimethylcarbamoyl)-2-hydroxyanilino]-3,4-dioxocyclobuten-1-yl]-[(1R,2S)-2-phenylcyclohexyl]azanide |
| SMILES | CN(C)C(=O)c1cccc(Nc2c([N-][C@@H]3CCCC[C@H]3c3ccccc3)c(=O)c2=O)c1O.[Li+] |
| InChI | InChI=1S/C25H27N3O4.Li/c1-28(2)25(32)17-12-8-14-19(22(17)29)27-21-20(23(30)24(21)31)26-18-13-7-6-11-16(18)15-9-4-3-5-10-15;/h3-5,8-10,12,14,16,18H,6-7,11,13H2,1-2H3,(H3,26,27,29,30,31,32);/q;+1/p-1/t16-,18+;/m0./s1 |
| InChIKey | UZMUZTSPBZYLTD-KUGOCAJQSA-M |
| XLogP | 1.17 |
| TPSA | 100.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.44 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|