C23H27N3O5 — CID 154540090
3-[[2-[[(1R)-1-(4-ethylfuran-2-yl)propyl]-methylamino]-3,4-dioxocyclobuten-1-yl]amino]-2-hydroxy-N,N-dimethylbenzamide (PubChem CID 154540090) has the molecular formula C23H27N3O5 and a molecular weight of 425.49 g/mol. Its IUPAC name is 3-[[2-[[(1R)-1-(4-ethylfuran-2-yl)propyl]-methylamino]-3,4-dioxocyclobuten-1-yl]amino]-2-hydroxy-N,N-dimethylbenzamide.
| Compound Name | 3-[[2-[[(1R)-1-(4-ethylfuran-2-yl)propyl]-methylamino]-3,4-dioxocyclobuten-1-yl]amino]-2-hydroxy-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 154540090 |
| Molecular Formula | C23H27N3O5 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | 3-[[2-[[(1R)-1-(4-ethylfuran-2-yl)propyl]-methylamino]-3,4-dioxocyclobuten-1-yl]amino]-2-hydroxy-N,N-dimethylbenzamide |
| SMILES | CCc1coc([C@@H](CC)N(C)c2c(Nc3cccc(C(=O)N(C)C)c3O)c(=O)c2=O)c1 |
| InChI | InChI=1S/C23H27N3O5/c1-6-13-11-17(31-12-13)16(7-2)26(5)19-18(21(28)22(19)29)24-15-10-8-9-14(20(15)27)23(30)25(3)4/h8-12,16,24,27H,6-7H2,1-5H3/t16-/m1/s1 |
| InChIKey | DOGFHWZRKIHCNP-MRXNPFEDSA-N |
| XLogP | 3.18 |
| TPSA | 103.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|