C24H31N3O5 — CID 142856720
3-[[2-[(4-butan-2-ylfuran-2-yl)methylamino]-3,4-dioxocyclobuten-1-yl]amino]-2-hydroxy-N,N-dimethylbenzamide;ethane (PubChem CID 142856720) has the molecular formula C24H31N3O5 and a molecular weight of 441.53 g/mol. Its IUPAC name is 3-[[2-[(4-butan-2-ylfuran-2-yl)methylamino]-3,4-dioxocyclobuten-1-yl]amino]-2-hydroxy-N,N-dimethylbenzamide;ethane.
| Compound Name | 3-[[2-[(4-butan-2-ylfuran-2-yl)methylamino]-3,4-dioxocyclobuten-1-yl]amino]-2-hydroxy-N,N-dimethylbenzamide;ethane |
|---|---|
| PubChem CID | 142856720 |
| Molecular Formula | C24H31N3O5 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | 3-[[2-[(4-butan-2-ylfuran-2-yl)methylamino]-3,4-dioxocyclobuten-1-yl]amino]-2-hydroxy-N,N-dimethylbenzamide;ethane |
| SMILES | CC.CCC(C)c1coc(CNc2c(Nc3cccc(C(=O)N(C)C)c3O)c(=O)c2=O)c1 |
| InChI | InChI=1S/C22H25N3O5.C2H6/c1-5-12(2)13-9-14(30-11-13)10-23-17-18(21(28)20(17)27)24-16-8-6-7-15(19(16)26)22(29)25(3)4;1-2/h6-9,11-12,23-24,26H,5,10H2,1-4H3;1-2H3 |
| InChIKey | CDPBAYQJDPJKGF-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 111.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|