C19H21N5O4S — CID 142883144
3-[[4-[[(1R)-1-(furan-2-yl)-2-methylprop-2-enyl]amino]-1-oxo-1,2,5-thiadiazol-3-yl]amino]-2-hydroxy-N,N-dimethylbenzamide (PubChem CID 142883144) has the molecular formula C19H21N5O4S and a molecular weight of 415.48 g/mol. Its IUPAC name is 3-[[4-[[(1R)-1-(furan-2-yl)-2-methylprop-2-enyl]amino]-1-oxo-1,2,5-thiadiazol-3-yl]amino]-2-hydroxy-N,N-dimethylbenzamide.
| Compound Name | 3-[[4-[[(1R)-1-(furan-2-yl)-2-methylprop-2-enyl]amino]-1-oxo-1,2,5-thiadiazol-3-yl]amino]-2-hydroxy-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 142883144 |
| Molecular Formula | C19H21N5O4S |
| Molecular Weight | 415.48 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 3-[[4-[[(1R)-1-(furan-2-yl)-2-methylprop-2-enyl]amino]-1-oxo-1,2,5-thiadiazol-3-yl]amino]-2-hydroxy-N,N-dimethylbenzamide |
| SMILES | C=C(C)[C@@H](NC1=NS(=O)N=C1Nc1cccc(C(=O)N(C)C)c1O)c1ccco1 |
| InChI | InChI=1S/C19H21N5O4S/c1-11(2)15(14-9-6-10-28-14)21-18-17(22-29(27)23-18)20-13-8-5-7-12(16(13)25)19(26)24(3)4/h5-10,15,25H,1H2,2-4H3,(H,20,22)(H,21,23)/t15-,29?/m1/s1 |
| InChIKey | BIKMOIKFLVKQFE-YHVXIASJSA-N |
| XLogP | 2.40 |
| TPSA | 119.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.48 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|