C16H17N3OS — CID 4942406
N,N-dimethyl-2-(phenylcarbamothioylamino)benzamide (PubChem CID 4942406) has the molecular formula C16H17N3OS and a molecular weight of 299.40 g/mol. Its IUPAC name is N,N-dimethyl-2-(phenylcarbamothioylamino)benzamide.
| Compound Name | N,N-dimethyl-2-(phenylcarbamothioylamino)benzamide |
|---|---|
| PubChem CID | 4942406 |
| Molecular Formula | C16H17N3OS |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | N,N-dimethyl-2-(phenylcarbamothioylamino)benzamide |
| SMILES | CN(C)C(=O)c1ccccc1NC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C16H17N3OS/c1-19(2)15(20)13-10-6-7-11-14(13)18-16(21)17-12-8-4-3-5-9-12/h3-11H,1-2H3,(H2,17,18,21) |
| InChIKey | UUBUSCQQQNTZCO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|