C30H26N4O4S2Se2 — CID 171447869
methyl 5-[[3-methoxycarbonyl-4-(phenylcarbamothioylamino)phenyl]diselanyl]-2-(phenylcarbamothioylamino)benzoate (PubChem CID 171447869) has the molecular formula C30H26N4O4S2Se2 and a molecular weight of 728.62 g/mol. Its IUPAC name is methyl 5-[[3-methoxycarbonyl-4-(phenylcarbamothioylamino)phenyl]diselanyl]-2-(phenylcarbamothioylamino)benzoate.
| Compound Name | methyl 5-[[3-methoxycarbonyl-4-(phenylcarbamothioylamino)phenyl]diselanyl]-2-(phenylcarbamothioylamino)benzoate |
|---|---|
| PubChem CID | 171447869 |
| Molecular Formula | C30H26N4O4S2Se2 |
| Molecular Weight | 728.62 g/mol |
| Exact Mass | 729.97 |
| IUPAC Name | methyl 5-[[3-methoxycarbonyl-4-(phenylcarbamothioylamino)phenyl]diselanyl]-2-(phenylcarbamothioylamino)benzoate |
| SMILES | COC(=O)c1cc([Se][Se]c2ccc(NC(=S)Nc3ccccc3)c(C(=O)OC)c2)ccc1NC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C30H26N4O4S2Se2/c1-37-27(35)23-17-21(13-15-25(23)33-29(39)31-19-9-5-3-6-10-19)41-42-22-14-16-26(24(18-22)28(36)38-2)34-30(40)32-20-11-7-4-8-12-20/h3-18H,1-2H3,(H2,31,33,39)(H2,32,34,40) |
| InChIKey | ZGEIJNXHFVTZQC-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 100.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.62 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|