C30H24N6O8S2Se2 — CID 170519198
methyl 5-[[3-methoxycarbonyl-4-[(4-nitrophenyl)carbamothioylamino]phenyl]diselanyl]-2-[(4-nitrophenyl)carbamothioylamino]benzoate (PubChem CID 170519198) has the molecular formula C30H24N6O8S2Se2 and a molecular weight of 818.61 g/mol. Its IUPAC name is methyl 5-[[3-methoxycarbonyl-4-[(4-nitrophenyl)carbamothioylamino]phenyl]diselanyl]-2-[(4-nitrophenyl)carbamothioylamino]benzoate.
| Compound Name | methyl 5-[[3-methoxycarbonyl-4-[(4-nitrophenyl)carbamothioylamino]phenyl]diselanyl]-2-[(4-nitrophenyl)carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 170519198 |
| Molecular Formula | C30H24N6O8S2Se2 |
| Molecular Weight | 818.61 g/mol |
| Exact Mass | 819.94 |
| IUPAC Name | methyl 5-[[3-methoxycarbonyl-4-[(4-nitrophenyl)carbamothioylamino]phenyl]diselanyl]-2-[(4-nitrophenyl)carbamothioylamino]benzoate |
| SMILES | COC(=O)c1cc([Se][Se]c2ccc(NC(=S)Nc3ccc([N+](=O)[O-])cc3)c(C(=O)OC)c2)ccc1NC(=S)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C30H24N6O8S2Se2/c1-43-27(37)23-15-21(11-13-25(23)33-29(45)31-17-3-7-19(8-4-17)35(39)40)47-48-22-12-14-26(24(16-22)28(38)44-2)34-30(46)32-18-5-9-20(10-6-18)36(41)42/h3-16H,1-2H3,(H2,31,33,45)(H2,32,34,46) |
| InChIKey | VVGKESPQEZHHJX-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 187.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.61 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|