C13H12N2O2S — CID 87654252
1-(2,4-dihydroxyphenyl)-3-phenylthiourea (PubChem CID 87654252) has the molecular formula C13H12N2O2S and a molecular weight of 260.32 g/mol. Its IUPAC name is 1-(2,4-dihydroxyphenyl)-3-phenylthiourea.
| Compound Name | 1-(2,4-dihydroxyphenyl)-3-phenylthiourea |
|---|---|
| PubChem CID | 87654252 |
| Molecular Formula | C13H12N2O2S |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 1-(2,4-dihydroxyphenyl)-3-phenylthiourea |
| SMILES | Oc1ccc(NC(=S)Nc2ccccc2)c(O)c1 |
| InChI | InChI=1S/C13H12N2O2S/c16-10-6-7-11(12(17)8-10)15-13(18)14-9-4-2-1-3-5-9/h1-8,16-17H,(H2,14,15,18) |
| InChIKey | ZJZRCPXJDHACMY-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|