C13H13NO2 — CID 21321415
4-(benzylamino)benzene-1,3-diol (PubChem CID 21321415) has the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. Its IUPAC name is 4-(benzylamino)benzene-1,3-diol.
| Compound Name | 4-(benzylamino)benzene-1,3-diol |
|---|---|
| PubChem CID | 21321415 |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 4-(benzylamino)benzene-1,3-diol |
| SMILES | Oc1ccc(NCc2ccccc2)c(O)c1 |
| InChI | InChI=1S/C13H13NO2/c15-11-6-7-12(13(16)8-11)14-9-10-4-2-1-3-5-10/h1-8,14-16H,9H2 |
| InChIKey | DCYBPNKGTJLPMD-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|