C16H14N2O2S — CID 4794352
4-[2-(benzylamino)-1,3-thiazol-4-yl]benzene-1,3-diol (PubChem CID 4794352) has the molecular formula C16H14N2O2S and a molecular weight of 298.37 g/mol. Its IUPAC name is 4-[2-(benzylamino)-1,3-thiazol-4-yl]benzene-1,3-diol.
| Compound Name | 4-[2-(benzylamino)-1,3-thiazol-4-yl]benzene-1,3-diol |
|---|---|
| PubChem CID | 4794352 |
| Molecular Formula | C16H14N2O2S |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 4-[2-(benzylamino)-1,3-thiazol-4-yl]benzene-1,3-diol |
| SMILES | Oc1ccc(-c2csc(NCc3ccccc3)n2)c(O)c1 |
| InChI | InChI=1S/C16H14N2O2S/c19-12-6-7-13(15(20)8-12)14-10-21-16(18-14)17-9-11-4-2-1-3-5-11/h1-8,10,19-20H,9H2,(H,17,18) |
| InChIKey | PBYTYQVOPNPPRS-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |