C15H12FN3S — CID 130556959
N-benzyl-4-(5-fluoro-3-pyridinyl)-1,3-thiazol-2-amine (PubChem CID 130556959) has the molecular formula C15H12FN3S and a molecular weight of 285.35 g/mol. Its IUPAC name is N-benzyl-4-(5-fluoro-3-pyridinyl)-1,3-thiazol-2-amine.
| Compound Name | N-benzyl-4-(5-fluoro-3-pyridinyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 130556959 |
| Molecular Formula | C15H12FN3S |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | N-benzyl-4-(5-fluoro-3-pyridinyl)-1,3-thiazol-2-amine |
| SMILES | Fc1cncc(-c2csc(NCc3ccccc3)n2)c1 |
| InChI | InChI=1S/C15H12FN3S/c16-13-6-12(8-17-9-13)14-10-20-15(19-14)18-7-11-4-2-1-3-5-11/h1-6,8-10H,7H2,(H,18,19) |
| InChIKey | ORBOOAIVKWENDA-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |