C19H14N2O2S — CID 3612453
3-[2-(benzylamino)-1,3-thiazol-4-yl]chromen-2-one (PubChem CID 3612453) has the molecular formula C19H14N2O2S and a molecular weight of 334.40 g/mol. Its IUPAC name is 3-[2-(benzylamino)-1,3-thiazol-4-yl]chromen-2-one.
| Compound Name | 3-[2-(benzylamino)-1,3-thiazol-4-yl]chromen-2-one |
|---|---|
| PubChem CID | 3612453 |
| Molecular Formula | C19H14N2O2S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 3-[2-(benzylamino)-1,3-thiazol-4-yl]chromen-2-one |
| SMILES | O=c1oc2ccccc2cc1-c1csc(NCc2ccccc2)n1 |
| InChI | InChI=1S/C19H14N2O2S/c22-18-15(10-14-8-4-5-9-17(14)23-18)16-12-24-19(21-16)20-11-13-6-2-1-3-7-13/h1-10,12H,11H2,(H,20,21) |
| InChIKey | NIPRRVRCFUUZTJ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|