C19H12ClN3O3S — CID 5146841
1-(3-chlorophenyl)-3-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]urea (PubChem CID 5146841) has the molecular formula C19H12ClN3O3S and a molecular weight of 397.84 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]urea |
|---|---|
| PubChem CID | 5146841 |
| Molecular Formula | C19H12ClN3O3S |
| Molecular Weight | 397.84 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]urea |
| SMILES | O=C(Nc1cccc(Cl)c1)Nc1nc(-c2cc3ccccc3oc2=O)cs1 |
| InChI | InChI=1S/C19H12ClN3O3S/c20-12-5-3-6-13(9-12)21-18(25)23-19-22-15(10-27-19)14-8-11-4-1-2-7-16(11)26-17(14)24/h1-10H,(H2,21,22,23,25) |
| InChIKey | YFBKMOCLNSAMNT-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.84 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|