C21H16N2O4S — CID 16911422
2-(3-methoxyphenyl)-N-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]acetamide (PubChem CID 16911422) has the molecular formula C21H16N2O4S and a molecular weight of 392.44 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)-N-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-(3-methoxyphenyl)-N-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 16911422 |
| Molecular Formula | C21H16N2O4S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | 2-(3-methoxyphenyl)-N-[4-(2-oxochromen-3-yl)-1,3-thiazol-2-yl]acetamide |
| SMILES | COc1cccc(CC(=O)Nc2nc(-c3cc4ccccc4oc3=O)cs2)c1 |
| InChI | InChI=1S/C21H16N2O4S/c1-26-15-7-4-5-13(9-15)10-19(24)23-21-22-17(12-28-21)16-11-14-6-2-3-8-18(14)27-20(16)25/h2-9,11-12H,10H2,1H3,(H,22,23,24) |
| InChIKey | ZBRNDHRVBGPICK-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|